F454821
Triethyl 4-phosphonocrotonate , Shunlian+transliteration, 94 , 10236-14-3
Synonym(s):
4-(Diethoxyphosphinyl)-2-butenoic acid ethyl ester;4-Phosphonocrotonic acid triethyl ester
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1018.40 | In Stock |
|
| 25g | RMB1919.20 | In Stock |
|
| 250g | RMB16324.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 135 °C0.4 mm Hg(lit.) |
| Density | 1.128 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Storage temp. 2-8°C |
| form | Liquid |
| color | Clear light yellow |
| InChI | 1S/C10H19O5P/c1-4-13-10(11)8-7-9-16(12,14-5-2)15-6-3/h7-8H,4-6,9H2,1-3H3/b8-7+ |
| InChIKey | LXLODBXSCRTXFG-BQYQJAHWSA-N |
| SMILES | CCOC(=O)\C=C\CP(=O)(OCC)OCC |
| CAS DataBase Reference | 10236-14-3(CAS DataBase Reference) |
Description and Uses
Reactant for:
- Iminodipropionic acid as a leaving group for DNA polymerization by HIV-1 reverse transcriptase
- Stereoselective preparation of C1-C19 fragment of macrolide antibiotic aplyronine A using diastereoselective Nozaki-Hiyama-Kishi coupling reactions
- Orally bioavailable GPR40 agonist synthesis
- Synthesis of fluoroketone inhibitors of group VIA calcium-independent phospholipase A2
- Preaparation of mGlu4R agonists
- Dearomatizing cyclization of nicotinyl-substituted esters and ketones
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
