PRODUCT Properties
| Melting point: | -105.8 °C |
| Boiling point: | 90 °C (lit.) |
| Density | 1.635 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| form | liquid |
| color | Clear |
| BRN | 2053012 |
| InChI | 1S/C5Cl2F6/c6-1-2(7)4(10,11)5(12,13)3(1,8)9 |
| InChIKey | ABPBVCKGWWGZDP-UHFFFAOYSA-N |
| SMILES | FC1(F)C(Cl)=C(Cl)C(F)(F)C1(F)F |
| CAS DataBase Reference | 706-79-6(CAS DataBase Reference) |
| EPA Substance Registry System | Cyclopentene, 1,2-dichloro-3,3,4,4,5,5-hexafluoro- (706-79-6) |
Description and Uses
1,2-Dichlorohexafluorocyclopentene may be used to synthesize:
- diarylperfluorocyclopentenes
- fluoro-bisthienylcyclopentenes (F-BTCs)
- 1,1-dichlorooctafluorocyclopentane
- 1,2-dichlorooctafluorocyclopentane
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H331-H315-H319-H335 |
| Precautionary statements | P261-P264-P301+P310-P302+P352-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi |
| Risk Statements | 22-23-36/37/38 |
| Safety Statements | 26-36-45 |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GY5976200 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2903898090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
