F482623
1-Adamantylzinc bromide , Null , 312624-15-0
| Pack Size | Price | Stock | Quantity |
| 50ml | RMB5612.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 0.97 g/mL at 25 °C |
| Flash point: | 1 °F |
| storage temp. | 2-8°C |
| Water Solubility | Reacts with water. |
| Sensitive | Air Sensitive |
| InChI | 1S/C10H15.BrH.Zn/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h7-9H,1-6H2;1H;/q;;+1/p-1/t7-,8+,9-;; |
| InChIKey | PUGQCSQHCXILTB-IQJVJNHNSA-M |
| SMILES | Br[Zn]C12C[C@H]3C[C@H](C[C@H](C3)C1)C2 |
Description and Uses
1-Adamantylzinc bromide is used as pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H261-H318-H333-H225-H250-H302-H314-H335-H351 |
| Precautionary statements | P210-P231-P280-P305+P351+P338-P370+P378-P422-P223-P303+P361+P353-P405-P501a |
| target organs | Central nervous system, Respiratory system |
| Hazard Codes | F,Xn,C |
| Risk Statements | 14-19-22-36/37/38-40-37-34-17-11 |
| Safety Statements | 16-23-26-36-45-36/37/39 |
| RIDADR | UN 2056 3/PG 2 |
| WGK Germany | 1 |
| HazardClass | 4.3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Flam. Liq. 2 Skin Corr. 1B STOT SE 3 |










