F498223
Boron silicide , 98 , 12008-29-6
CAS NO.：12008-29-6
Empirical Formula: B6Si
Molecular Weight: 92.95
MDL number: MFCD00180907
EINECS: 234-535-8
| Pack Size | Price | Stock | Quantity |
| 10g | RMB1075.20 | In Stock |
|
| 50g | RMB3500.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 2540℃ [KIR78] |
| Density | 2.470 |
| form | Powder |
| Specific Gravity | 2.430 |
| color | black crystals, crystalline |
| Resistivity | 200,000 (ρ/μΩ.cm) |
| Water Solubility | Insoluble in water. |
| Crystal Structure | Trigonal |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/B6Si/c1-2-5-3(1)7(5)4(1)6(2)7 |
| InChIKey | ZRBFEDMQRDRUDG-UHFFFAOYSA-N |
| SMILES | [Si]123B4B5B(B14)B2B35 |
| CAS DataBase Reference | 12008-29-6(CAS DataBase Reference) |
| EPA Substance Registry System | Boron silicide (B6Si) (12008-29-6) |
Description and Uses
Boron silicide is used in chemical research, pharmaceuticals and as an intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | No |
