F532122
7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline , 97 , 450-62-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB402.40 | In Stock |
|
| 1g | RMB1154.40 | In Stock |
|
| 5g | RMB5074.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30-32°C |
| Boiling point: | 135-140°C 22mm |
| Density | 1.213±0.06 g/cm3(Predicted) |
| Flash point: | 135-140°C/22mm |
| storage temp. | 2-8°C, protect from light |
| form | low melting solid |
| pka | 4.09±0.20(Predicted) |
| color | Pale yellow |
| BRN | 153990 |
| InChI | InChI=1S/C10H10F3N/c11-10(12,13)8-4-3-7-2-1-5-14-9(7)6-8/h3-4,6,14H,1-2,5H2 |
| InChIKey | RGZZKZNESVFQKR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC(C(F)(F)F)=C2)CCC1 |
| CAS DataBase Reference | 450-62-4(CAS DataBase Reference) |
Description and Uses
7-(Trifluoromethyl)-1,2,3,4-tetrahydroquinoline is used for stereoselective preparation of difunctionalized dienes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |






