F539923
Calcium 2-ethylhexanoate , 98 , 136-51-6
Synonym(s):
2-Ethylhexanoic acid calcium salt;Calcium bis(2-ethyl hexanoate)
CAS NO.：136-51-6
Empirical Formula: C16H30CaO4
Molecular Weight: 326.48
MDL number: MFCD00014001
EINECS: 205-249-0
| Pack Size | Price | Stock | Quantity |
| 5g | RMB732.80 | In Stock |
|
| 25g | RMB2450.40 | In Stock |
|
| 100g | RMB8380.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.07[at 20℃] |
| vapor pressure | 0-4Pa at 20℃ |
| form | liquid |
| Water Solubility | Insoluble in water. |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | 1S/2C8H16O2.Ca/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | LTPCXXMGKDQPAO-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)O[Ca]OC(=O)C(CC)CCCC |
| LogP | 2.7 at 25℃ |
| CAS DataBase Reference | 136-51-6(CAS DataBase Reference) |
| EPA Substance Registry System | Calcium 2-ethylhexanoate (136-51-6) |
Description and Uses
Calcium 2-ethylhexanoate is used as an organic chemical synthesis intermediate.
Safety
| Symbol(GHS) |   GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H318-H361d |
| Precautionary statements | P202-P280-P305+P351+P338-P308+P313-P405-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29159080 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |
