F572221
Zirconium(IV) isopropoxide isopropanol complex , Null , 14717-56-7
CAS NO.:14717-56-7
Empirical Formula: C12H28O4Zr.C3H8O
Molecular Weight: 387.668
MDL number: MFCD00075157
EINECS: 629-318-3
| Pack Size | Price | Stock | Quantity |
| 10g | RMB5226.40 | In Stock |
|
| 50g | RMB23516.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| solubility | Soluble in hot isopropanol, warm hexane and toluene. Tends to precipitate over time. |
| form | crystal |
| color | white |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C3H8O.4C3H7O.Zr/c5*1-3(2)4;/h3-4H,1-2H3;4*3H,1-2H3;/q;4*-1;+4 |
| InChIKey | NIJDLRJGRCHJDB-UHFFFAOYSA-N |
| SMILES | CC(C)O.CC(C)O[Zr](OC(C)C)(OC(C)C)OC(C)C |
Description and Uses
Zirconium(IV) Isopropoxide Isopropanol Complex are efficient and good catalysts for the ring-opening polymerization of rac-lactides and ε-caprolactone as well as δ-valerolactone, rac-β-butyrolactone, ethylene and propylene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | UN3180 |
| WGK Germany | 3 |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 2905190098 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






