F592922
1-(4-Nitrophenyl)glycerol , 99 , 2207-68-3
Synonym(s):
α-(p-Nitrophenyl)glycerol;α-p-Nitrophenylglycerol;1-(4-Nitrophenyl)-1,2,3-propanetriol;PNPG
CAS NO.:2207-68-3
Empirical Formula: C9H11NO5
Molecular Weight: 213.19
MDL number: MFCD00017037
EINECS: 218-624-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB1450.40 | In Stock |
|
| 1g | RMB4392.80 | In Stock |
|
| 5g | RMB17580.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 98-101 °C(lit.) |
| Boiling point: | 353.17°C (rough estimate) |
| Density | 1.3707 (rough estimate) |
| refractive index | 1.5270 (estimate) |
| storage temp. | 2-8°C |
| form | crystalline |
| pka | 12.76±0.20(Predicted) |
| color | off-white |
| PH | 4-7 (10g/l, H2O, 20℃) |
| Sensitive | Hygroscopic |
| BRN | 7376091 |
| InChI | 1S/C9H11NO5/c11-5-8(12)9(13)6-1-3-7(4-2-6)10(14)15/h1-4,8-9,11-13H,5H2 |
| InChIKey | IUZVZBIQZKBWCC-UHFFFAOYSA-N |
| SMILES | OCC(O)C(O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 2207-68-3(CAS DataBase Reference) |
Description and Uses
1-(4(Nitrophenyl)glycerol is a useful additive for controlling swarming of Proteus bacteria on culture media.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant |
| HS Code | 29062990 |
| Storage Class | 11 - Combustible Solids |



