F626622
Dichloroethylmethylsilane , 94 , 4525-44-4
Synonym(s):
Ethylmethyldichlorosilane
CAS NO.：4525-44-4
Empirical Formula: C3H8Cl2Si
Molecular Weight: 143.09
MDL number: MFCD00013607
EINECS: 224-860-3
| Pack Size | Price | Stock | Quantity |
| 10g | RMB657.60 | In Stock |
|
| 50g | RMB1843.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8°C |
| Boiling point: | 100 °C(lit.) |
| Density | 1.063 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 54 °F |
| Specific Gravity | 1.063 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| BRN | 1361374 |
| InChI | InChI=1S/C3H8Cl2Si/c1-6-2-3(4)5/h3H,2,6H2,1H3 |
| InChIKey | BYKDIAHBFKIHHS-UHFFFAOYSA-N |
| SMILES | [SiH2](CC(Cl)Cl)C |
| CAS DataBase Reference | 4525-44-4(CAS DataBase Reference) |
| EPA Substance Registry System | Silane, dichloroethylmethyl- (4525-44-4) |
Description and Uses
Ethylmethyldichlorosilane is the raw material for producing silicone rubber and silicone resin. Silicone resins has many advantages over natural rubber.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H225-H314-H318 |
| Precautionary statements | P260h-P303+P361+P353-P405-P501a-P210-P280-P305+P351+P338-P310 |
| Hazard Codes | F,C |
| Risk Statements | 11-34 |
| Safety Statements | 16-26-28-36/37/39-45 |
| RIDADR | UN 2985 3/PG 2 |
| WGK Germany | 1 |
| F | 10-21 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29319090 |
