F644623
1,1-Dichloroacetone , 95 , 513-88-2
Synonym(s):
1,1-Dichloroacetone
CAS NO.:513-88-2
Empirical Formula: C3H4Cl2O
Molecular Weight: 126.97
MDL number: MFCD00009677
EINECS: 208-175-7
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 117-118 °C(lit.) |
| Density | 1.327 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 99-100 °F |
| storage temp. | Flammables area |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Merck | 14,3051 |
| BRN | 1740214 |
| Henry's Law Constant | 3.3×10-1 mol/(m3Pa) at 25℃, Burkholder et al. (2019) |
| Stability: | Volatile |
| Major Application | environmental |
| InChI | InChI=1S/C3H4Cl2O/c1-2(6)3(4)5/h3H,1H3 |
| InChIKey | CSVFWMMPUJDVKH-UHFFFAOYSA-N |
| SMILES | C(Cl)(Cl)C(=O)C |
| CAS DataBase Reference | 513-88-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1,1-Dichloropropanone (513-88-2) |
Description and Uses
1,1-Dichloro-2-propanone is a disinfection byproduct in drinking water. It may cause bladder cancer and other adverse health effects.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H314-H317-H332-H411 |
| Precautionary statements | P264-P270-P260-P280-P261-P272-P271-P273-P301+P310-P330-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P305+P351+P338-P302+P352-P333+P313-P362+P364-P312-P391-P405-P501 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 10-22 |
| Safety Statements | 16 |
| RIDADR | UN 1992 3/PG 3 |
| WGK Germany | 3 |
| RTECS | UC1428000 |
| F | 3-19 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29147000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
| Hazardous Substances Data | 513-88-2(Hazardous Substances Data) |
| REACH Registrations | Inactive |









