F679221
1,2-Bis(dimethoxyphosphoryl)benzene , 99 , 15104-46-8
| Pack Size | Price | Stock | Quantity |
| 0.5g | RMB325.60 | In Stock |
|
| 2g | RMB1166.40 | In Stock |
|
| 10g | RMB5888.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 79-84 °C |
| Boiling point: | 373.6±25.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| form | crystal |
| color | white |
| InChI | InChI=1S/C10H16O6P2/c1-13-17(11,14-2)9-7-5-6-8-10(9)18(12,15-3)16-4/h5-8H,1-4H3 |
| InChIKey | TUKTVDDATWNXSN-UHFFFAOYSA-N |
| SMILES | C1(=CC=CC=C1P(=O)(OC)OC)P(=O)(OC)OC |
| CAS DataBase Reference | 15104-46-8(CAS DataBase Reference) |
Description and Uses
Tetramethyl-1,2-phenylenediphosphonate is a useful reagent for the synthesis of 1,2-bis(phosphino)benzene and related alkylated species.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 24/25 |
| RIDADR | UN3464 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29199000 |
