F693221
4-n-Decylbenzoyl chloride , 98 , 54256-43-8
CAS NO.:54256-43-8
Empirical Formula: C17H25ClO
Molecular Weight: 280.83
MDL number: MFCD00041724
EINECS: 259-046-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB488.80 | In Stock |
|
| 5g | RMB1902.40 | In Stock |
|
| 25g | RMB7556.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 172 °C (2 mmHg) |
| Density | 1.0114 (estimate) |
| refractive index | 1.512-1.514 |
| Flash point: | 171-173°C/2mm |
| form | solid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C17H25ClO/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)17(18)19/h11-14H,2-10H2,1H3 |
| InChIKey | HEWLDHSFOQXCSI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCc1ccc(cc1)C(Cl)=O |
| EPA Substance Registry System | Benzoyl chloride, 4-decyl- (54256-43-8) |
Description and Uses
Employed as a pharmaceutical and chemical intermediate.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-36 |
| Safety Statements | 24/25 |
| RIDADR | 3265 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |







