F774723
Triacetoxy(vinyl)silane , 95 , 4130-08-9
Synonym(s):
(Triacetoxysilyl)ethylene;Vinyltriacetoxysilane
CAS NO.:4130-08-9
Empirical Formula: C8H12O6Si
Molecular Weight: 232.26
MDL number: MFCD00014975
EINECS: 223-943-1
| Pack Size | Price | Stock | Quantity |
| 50g | RMB676.00 | In Stock |
|
| 250g | RMB1606.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 7 °C |
| Boiling point: | 175 °C/10 mmHg (lit.) |
| Density | 1.167 g/mL at 25 °C (lit.) |
| vapor pressure | 1.47Pa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| form | liquid |
| Specific Gravity | 1.167 (20℃) |
| color | colorless to pale yellow |
| Odor | Mild odor |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1792454 |
| InChI | 1S/C8H12O6Si/c1-5-15(12-6(2)9,13-7(3)10)14-8(4)11/h5H,1H2,2-4H3 |
| InChIKey | NOZAQBYNLKNDRT-UHFFFAOYSA-N |
| SMILES | CC(=O)O[Si](OC(C)=O)(OC(C)=O)C=C |
| LogP | 0.6 |
| CAS DataBase Reference | 4130-08-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Triacetoxy(vinyl)silane(4130-08-9) |
| EPA Substance Registry System | Vinylsilanetriol triacetate (4130-08-9) |
Description and Uses
Vinyltriacetoxysilane is an organosilicon compound used in various industrial applications due to its ability to act as a coupling agent and crosslinking agent.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34-37-14 |
| Safety Statements | 26-36/37/39-45-8 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |





