F828623
2-Adamantylzinc bromide , Null , 171860-65-4
| Pack Size | Price | Stock | Quantity |
| 50ml | RMB4341.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 65 °C |
| Density | 1.018 g/mL at 25 °C |
| Flash point: | 1 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Yellow to brown to black |
| Water Solubility | Reacts with water. |
| Sensitive | Air Sensitive |
| Exposure limits | ACGIH: TWA 50 ppm; STEL 100 ppm (Skin) OSHA: TWA 200 ppm(590 mg/m3) NIOSH: IDLH 2000 ppm; TWA 200 ppm(590 mg/m3); STEL 250 ppm(735 mg/m3) |
| InChI | 1S/C10H15.BrH.Zn/c1-7-2-9-4-8(1)5-10(3-7)6-9;;/h1,7-10H,2-6H2;1H;/q;;+1/p-1/t7-,8+,9-,10+;; |
| InChIKey | HHXSMOCPPVCAHH-DHNWFJROSA-M |
| SMILES | Br[Zn]C1[C@H]2C[C@@H]3C[C@H](C2)C[C@H]1C3 |
Description and Uses
2-Adamantylzinc bromide used as a intermediate for pharmaceutical.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H261-H314-H318-H333-H225-H302-H319-H335-H351 |
| Precautionary statements | P210-P280-P301+P312+P330-P305+P351+P338-P370+P378-P403+P235-P223-P303+P361+P353-P405-P501a |
| target organs | Central nervous system, Respiratory system |
| Hazard Codes | F,Xn |
| Risk Statements | 14-19-22-36/38-40-36/37-11 |
| Safety Statements | 16-26-33-36-36/37 |
| RIDADR | UN 2056 3/PG 2 |
| WGK Germany | 1 |
| HazardClass | 4.3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Flam. Liq. 2 STOT SE 3 |










