F834521
Cesium chromate , 99+ , 13454-78-9
Synonym(s):
Caesium chromate;Chromic acid cesium salt
CAS NO.:13454-78-9
Empirical Formula: CrCsH3O4
Molecular Weight: 251.92
MDL number: MFCD00016050
EINECS: 236-640-4
| Pack Size | Price | Stock | Quantity |
| 10g | RMB624.00 | In Stock |
|
| 50g | RMB1103.20 | In Stock |
|
| 250g | RMB4404.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| form | Powder |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| Exposure limits | OSHA: Ceiling 0.1 mg/m3 NIOSH: IDLH 15 mg/m3; TWA 0.0002 mg/m3 |
| InChI | 1S/Cr.2Cs.4O/q;2*+1;;;2*-1 |
| InChIKey | BROHICCPQMHYFY-UHFFFAOYSA-N |
| SMILES | [Cs+].[Cs+].[O-][Cr]([O-])(=O)=O |
| CAS DataBase Reference | 13454-78-9(CAS DataBase Reference) |
| EPA Substance Registry System | Chromic acid (H2CrO4), dicesium salt (13454-78-9) |
Description and Uses
Cesium chromate is used to produce cesium vapor by reaction with silicon, boron, or titanium, which is used in the final stages of creating vacuum tubes. It is used in the production of photo-tubes.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS03,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H350-H400-H272-H317-H350i-H410 |
| Precautionary statements | P201-P220-P273-P280-P308+P313-P501-P210-P333+P313-P261-P405-P501a |
| Hazard Codes | O,T,N |
| Risk Statements | 45-46-8-36/37/38-50/53-43-49 |
| Safety Statements | 53-17-26-27-36/37/39-45-61-60 |
| RIDADR | UN 1479 5.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 5.1 |
| PackingGroup | III |
| Storage Class | 5.1B - Oxidizing hazardous materials |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Carc. 1B Ox. Sol. 2 Skin Sens. 1 |








