F966421
Potassium benzofurazan-5-trifluoroborate , Null
Synonym(s):
Potassium benzo[c][1,2,5]oxadiazole-5-trifluoroborate
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1473.60 | In Stock |
|
| 5g | RMB4520.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300°C |
| form | solid |
| InChI | 1S/C6H3BF3N2O.K/c8-7(9,10)4-1-2-5-6(3-4)12-13-11-5;/h1-3H;/q-1;+1 |
| InChIKey | VVXGHNBCIPLVLI-UHFFFAOYSA-N |
| SMILES | [K+].F[B-](F)(F)c1ccc2nonc2c1 |
Description and Uses
Organotrifluoroborate invovled in copper-mediated cross-coupling and Suzuki cross-coupling
Organotrifluoroborates as versatile and stable boronic acid surrogates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







