LN-006534
10-Keto DextroMethorphan , 0.95 , 57969-05-8
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 184-186°C |
| Boiling point: | 446.2±45.0 °C(Predicted) |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Controlled Substance, -20°C Freezer |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.63±0.20(Predicted) |
| color | Pale Yellow |
| Major Application | pharmaceutical |
| InChI | 1S/C18H23NO2/c1-19-10-9-18-8-4-3-5-14(18)16(19)17(20)13-7-6-12(21-2)11-15(13)18/h6-7,11,14,16H,3-5,8-10H2,1-2H3/t14-,16-,18+/m1/s1 |
| InChIKey | UOCRGKKCNCIQCZ-KYJSFNMBSA-N |
| SMILES | N1([C@@H]2[C@@H]3[C@@](CC1)(CCCC3)c4c(ccc(c4)OC)C2=O)C |
Description and Uses
A product formed from the photochemical reaction of Dextromethorphan (D299455) after light or sunlight exposure.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| target organs | Central nervous system |
| WGK Germany | WGK 3 |
| HS Code | 2933497050 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral STOT SE 3 |
