LN-0137Di
Diclofop , 99% , 40843-25-2
Synonym(s):
(RS)-2-[4-(2,4-Dichlorophenoxy)phenoxy]propionic acid
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 107°C |
| Boiling point: | 440.5±45.0 °C(Predicted) |
| Density | 1.386±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 3.19±0.10(Predicted) |
| color | White |
| BRN | 2338390 |
| Henry's Law Constant | 9.2×105 mol/(m3Pa) at 25℃, Ebert et al. (2023) |
| Major Application | agriculture environmental |
| InChI | 1S/C15H12Cl2O4/c1-9(15(18)19)20-11-3-5-12(6-4-11)21-14-7-2-10(16)8-13(14)17/h2-9H,1H3,(H,18,19) |
| InChIKey | OOLBCHYXZDXLDS-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(Oc2ccc(Cl)cc2Cl)cc1)C(O)=O |
| LogP | 4.580 |
| NIST Chemistry Reference | Diclofop(40843-25-2) |
| EPA Substance Registry System | Diclofop (40843-25-2) |
Description and Uses
Diclofop is a grass herbicide which is usually used as the methyl variant. It is highly soluble in water and is not considered to be volatile. It is not normally environmentally persistent. Diclofop is moderately toxic to mammals via the oral route. Its toxicity to biodiversity tends to be moderate to low.
(±)-Diclofop is an Acetyl-CoA carboxylase (ACCase) inhibiting herbicide.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN3077(solid) |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
