LN-041725
KWD 2066 , 0.99 , 96948-64-0
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 172-173.5 °C |
| Boiling point: | 361.8±27.0 °C(Predicted) |
| Density | 1.079±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.97±0.26(Predicted) |
| form | solid |
| color | Off-White |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | 1S/C12H19NO2/c1-12(2,3)13-8-11(15)9-4-6-10(14)7-5-9/h4-7,11,13-15H,8H2,1-3H3 |
| InChIKey | JOGFUYPGDLRKHD-UHFFFAOYSA-N |
| SMILES | N(C(C)(C)C)CC(O)c1ccc(cc1)O |
Description and Uses
t-Butylnorsynephrine is a derivative of norsynephrine, an endogenous biogenic amine that is closely related to norepinephrine, which has effects on the adrenergic and dopaminergic system. Structure and activity tudies have shown that t-Butylnorsynephrine may also exhibit effects towards β-adrenergic receptors and β-adrenergic receptor-coupled adenylate cyclase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![alpha-[(benzyl-tert-butylamino)methyl]-m-xylene-4,alpha,alpha'-triol](https://img.chemicalbook.com/CAS/GIF/24085-03-8.gif)

