LN-189128
2,4-Xylenesulfonic acid , 0.95 , 25321-41-9
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 290.72°C (rough estimate) |
| Density | 1.3286 (rough estimate) |
| refractive index | 1.5250 (estimate) |
| Cosmetics Ingredients Functions | SURFACTANT - CLEANSING SURFACTANT - HYDROTROPE |
| InChI | InChI=1S/C8H10O3S/c1-6-3-4-8(7(2)5-6)12(9,10)11/h3-5H,1-2H3,(H,9,10,11) |
| InChIKey | CHZLVSBMXZSPNN-UHFFFAOYSA-N |
| SMILES | S(=O)(=O)(O)C1C=CC(C)=CC=1C |
| LogP | 1.390 (est) |
| CAS DataBase Reference | 25321-41-9(CAS DataBase Reference) |
| EPA Substance Registry System | Xylenesulfonic acid (25321-41-9) |
Description and Uses
2,4-Xylenesulfonic acid is mainly used as a catalyst for phenolic and furan resin sand core or mold curing systems.
Safety
| Symbol(GHS) |   GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H315-H335 |
| Precautionary statements | P260-P264-P280-P301+P330+P331-P303+P361+P353-P363-P304+P340-P310-P321-P305+P351+P338-P405-P501-P264-P280-P302+P352-P321-P332+P313-P362 |
| RIDADR | 2586 |
| HazardClass | 8 |
| PackingGroup | III |
