LN-252734
6,8-DIFLUORO-7-HYDROXY-4-METHYLCOUMARIN , 0.95 , 215868-23-8
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 213-215°C |
| Boiling point: | 332.3±42.0 °C(Predicted) |
| Density | 1.494±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Insoluble in water; soluble in chloroform,
N,N-dimethylformamide, dimethyl sulfoxide |
| pka | 4.7, (at 22℃)
(calcd.) 5.50 ± 0.20, most acidic, temperature:
25 °C |
| form | Off-White to Pale Yellow Soild |
| color | Colorless needles; white solid |
| λmax | 358 nm (Buffers pH 10.0, pH 9.0) |
| Stability: | Hygroscopic |
| Major Application | Detecting/quantifying/measuring metals (beryllium, chromium, lead) |
| Biological Applications | Amplifying/detectingnucleic acid sequences; analyzing peptides, sugarchains; detecting bacteria; detecting/quantifyingnucleic acids; a substrate for measuring acylprotein thioesterase (APT) activity,, α-amylaseactivity, aryl sulfatases activity, β-galactosidasesactivity,,, guanidinobenzoatase activity, β-lactamaseactivity, lipase activity, phosphatases activity,,phospholipase LYPLAL activity, protein kinasesactivity, xylanase activity; diagnosing/treatingtraumatic brain injury; treating amyloidogenic disease;as temperature sensor, |
| InChIKey | LLENVBUPWUQAGL-UHFFFAOYSA-N |
| SMILES | FC1=C2C(C(C)=CC(O2)=O)=CC(F)=C1O |
Description and Uses
6,8-Difluoro-7-hydroxy-4-methylcoumarin (DIFMU) was used for the diagnostic detection of natural killer cell-activity.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317 |
| Precautionary statements | P261-P264-P272-P280-P301+P310-P302+P352 |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |


