LN-353027
Perindopril L-Arginine , 98%+ , 612548-45-5
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >116°C (dec.) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Water: 100 mg/mL (184.27 mM) |
| Stability: | Hygroscopic |
| InChIKey | RYCSJJXKEWBUTI-IXCFSXOZNA-N |
| SMILES | C([C@H](N)C(=O)O)CCNC(N)=N.C(N1[C@@H](C[C@]2([H])CCCC[C@]12[H])C(=O)O)(=O)[C@H](C)N[C@@H](CCC)C(=O)OCC |&1:1,14,16,22,28,31,r| |
Description and Uses
Perindopril L-Arginine, is a complex compound of Perindopril (P287500), having the antihypertensive, cardiovascular protective and antithrombotic properties, and has been shown to exists as a neutral complex.
