LN-372522
Oxymetazoline , 0.97 , 1491-59-4
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 182 °C |
| Boiling point: | 403.63°C (rough estimate) |
| Density | 0.9822 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| pka | 11.93±0.28(Predicted) |
| color | Crystals from C6H6 |
| InChI | InChI=1S/C16H24N2O/c1-10-8-13(16(3,4)5)15(19)11(2)12(10)9-14-17-6-7-18-14/h8,19H,6-7,9H2,1-5H3,(H,17,18) |
| InChIKey | WYWIFABBXFUGLM-UHFFFAOYSA-N |
| SMILES | C1(O)=C(C(C)(C)C)C=C(C)C(CC2NCCN=2)=C1C |
| CAS DataBase Reference | 1491-59-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Oxymetazoline(1491-59-4) |
Description and Uses
Oxymetazoline is used for the same indications as naphazoline, primarily for rhinitis.
Safety
| Symbol(GHS) |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H412-H318-H300-H330 |
| Precautionary statements | P273-P501-P260-P271-P284-P304+P340-P310-P320-P403+P233-P405-P501-P280-P305+P351+P338-P310-P264-P270-P301+P310-P321-P330-P405-P501 |
| RIDADR | 3249 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Hazardous Substances Data | 1491-59-4(Hazardous Substances Data) |
| Toxicity | LD50 orl-rat: 800 mg/kg TXAPA9 18,185,71 |
