LN-384333
clanobutin , 99 , 30544-61-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 115-116° |
| Boiling point: | 562.4±50.0 °C(Predicted) |
| Density | 1.1976 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 5.04(at 25℃) |
| color | White to Off-White |
| Water Solubility | 44.17mg/L(37 ºC) |
| InChI | InChI=1S/C18H18ClNO4/c1-24-16-10-8-15(9-11-16)20(12-2-3-17(21)22)18(23)13-4-6-14(19)7-5-13/h4-11H,2-3,12H2,1H3,(H,21,22) |
| InChIKey | VUPBWNXFSDRWJE-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCCN(C(=O)C1=CC=C(Cl)C=C1)C1=CC=C(OC)C=C1 |
Description and Uses
Clanobutin inhibits gluconeogenesis in isolated perfused rat livers. it is a a choleretic and digestion-stimulating agent for animals.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H315-H335 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Toxicity | LD50 in rats (mg/kg): >2000 orally; 570 i.v. (Klemm) |





