LN-393926
Methohexital , 151-83-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 96 °C(Solv: ethanol (64-17-5)) |
| Density | 1.113 |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 7.82±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C14H18N2O3/c1-5-7-8-10(3)14(9-6-2)11(17)15-13(19)16(4)12(14)18/h6,10H,2,5,9H2,1,3-4H3,(H,15,17,19) |
| InChIKey | NZXKDOXHBHYTKP-UHFFFAOYSA-N |
| SMILES | N1(C(=O)NC(=O)C(C1=O)(C(C)C#CCC)CC=C)C |
| NIST Chemistry Reference | Methohexitone(151-83-7) |
Description and Uses
Methohexital is a short-acting barbiturate used as a sedative. Methohexital is used an anesthetic for oral surgery and dentistry and is also used to induce anesthesia prior to electroconvulsive therapy (ECT). Methohexital is a Controlled Substance.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P330+P331+P310 |
| Hazard Codes | F,T |
| Risk Statements | 11-23/24/25-39/23/24/25 |
| Safety Statements | 16-36/37-45 |
| RIDADR | 3249 |
| WGK Germany | WGK 3 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 2933599550 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | An ultra-short-acting i.v. anesthetic. Because its use causes respiratory depression, apnea, and hypotension, establishment and maintenance of airways, oxygen administration, etc. are required. Various allergic responses have sometimes been reported with its use. |
