LN-455933
(S)-Pro-xylane , 95%+ , 868156-46-1
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 376.0±42.0 °C(Predicted) |
| Density | 1.368±0.06 g/cm3(Predicted) |
| storage temp. | 4°C, away from moisture and light |
| solubility | DMSO: 250 mg/mL (1300.66 mM) |
| pka | 13.55±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | InChI=1/C8H16O5/c1-4(9)2-6-8(12)7(11)5(10)3-13-6/h4-12H,2-3H2,1H3/t4-,5+,6-,7-,8-/s3 |
| InChIKey | KOGFZZYPPGQZFZ-FHYXRTTRNA-N |
| SMILES | C([C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O)[C@@H](O)C |&1:1,4,6,8,10,r| |
Description and Uses
(S)-Pro-xylane is the S-enantiomer of Pro-xylane. Pro-xylane, a biologically active C-glycoside in aqueous media, acts as an activator of glycosaminoglycans (GAGs) biosynthesis.
(S)-Pro-xylane (Hydroxypropyl tetrahydropyrantriol) is a C-glycoside, a xylose derivative, that stimulates the production of glycosaminoglycans (GAGs) and heparan sulfate proteoglycans (HSPGs) and induces a higher deposition of proteins in basement membranes and dermal-epidermal junctions (DEJs). Pro-xylane is used to maintain skin elasticity and improve skin aging.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |


