LN-534631
Valsartan Impurity 32 , 152708-24-2
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 40 - 43°C |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Pale Beige |
| Stability: | Light Sensitive |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C14H11N7/c15-19-16-9-10-5-7-11(8-6-10)12-3-1-2-4-13(12)14-17-20-21-18-14/h1-8H,9H2,(H,17,18,20,21) |
| InChIKey | HIWODOJPZXUTRT-UHFFFAOYSA-N |
| SMILES | C(C1C=CC(C2C=CC=CC=2C2=NN=NN2)=CC=1)N=[N+]=[N-] |
Description and Uses
Des-[(S)-3-Methyl-2-pentanamidobutanoic Acid] Valsartan 4’-Azidomethyl is an impurity of Valsartan (V095750). A nonpeptide angiotensin II AT1-receptor antagonist. Antihypertensive. Impurity of all “sartan” based drugs (2021).
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Warning |
| Hazard statements | H341-H361 |
| Precautionary statements | P201-P202-P281-P308+P313-P405-P501-P201-P202-P281-P308+P313-P405-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Muta. 2 |