LN-545430
Pyridat , 55512-33-9
CAS NO.：55512-33-9
Empirical Formula: C19H23ClN2O2S
Molecular Weight: 378.92
MDL number: MFCD00078718
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 27° |
| Boiling point: | bp0.1 220° |
| Density | d20 1.555 |
| refractive index | nD20 1.568 |
| Flash point: | 100 °C |
| storage temp. | 2-8°C |
| pka | -0.84±0.10(Predicted) |
| Merck | 13,8058 |
| BRN | 759528 |
| Major Application | agriculture environmental |
| InChI | 1S/C19H23ClN2O2S/c1-2-3-4-5-6-10-13-25-19(23)24-16-14-17(20)21-22-18(16)15-11-8-7-9-12-15/h7-9,11-12,14H,2-6,10,13H2,1H3 |
| InChIKey | JTZCTMAVMHRNTR-UHFFFAOYSA-N |
| SMILES | CCCCCCCCSC(=O)Oc1cc(Cl)nnc1-c2ccccc2 |
| LogP | 6.840 (est) |
| CAS DataBase Reference | 55512-33-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Carbonothioic acid, o-(6-chloro-3-phenyl-4-pyridazinyl) s-octyl ester(55512-33-9) |
| EPA Substance Registry System | Pyridate (55512-33-9) |
Description and Uses
Pyridat, which is a herbicide used in agriculture. Pyridat has been used to control annual broadleaved weeds in sweet corn, cauliflower, broccoli and leek.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H410 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi,N |
| Risk Statements | 38-43-50/53 |
| Safety Statements | 24-37-60-61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| RTECS | FG3880000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Irrit. 2 Skin Sens. 1 |
| Toxicity | LD50 in male rats, female rats, mice (mg/kg): 1970, 2400, >10,000 orally; in rabbits (mg/kg): >3450 dermally; LC50 (96 hr) in carp, trout: >100, 81 mg/l (Chéroux, Moncorge) |
