LN-560126
                    FUMARIC ACID MONOETHYL ESTER, ZINC SALT , 0.98 , 62008-21-3
Update time: 2023-04-23
                    PRODUCT Properties
| Melting point: | 300 °C (dec.)(lit.) | 
                                    
| storage temp. | Refrigerator, under inert atmosphere | 
                                    
| solubility | DMSO (Slightly), Water (Slightly) | 
                                    
| form | Solid | 
                                    
| color | Off-White | 
                                    
| InChI | InChI=1S/2C6H8O4.Zn/c2*1-2-10-6(9)4-3-5(7)8;/h2*3-4H,2H2,1H3,(H,7,8);/q;;+2/p-2/b2*4-3+; | 
                                    
| InChIKey | DASOVGGSCVXZMC-SYWGCQIGSA-L | 
                                    
| SMILES | C(=O)(O[Zn]OC(=O)/C=C/C(=O)OCC)/C=C/C(=O)OCC | 
                                    
Description and Uses
Fumaric Acid Monoethyl Ester Zinc Salt, is the salt of Fumaric Acid Monoethyl Ester (F500385), which is an anti-psoriatic fumaric acid ester. Fumaric Acid Monoethyl Ester inhibited thymidine-14C incorporation into DNA by cultured human lymphocytes. Fumaric Acid Monoethyl Ester has been shown to evoke transient increase in intracellular free calcium concentration and inhibit proliferation of human keratinocytes.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H335-H319 | 
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 1 | 







