LN-583331
2-NP-AMOZ-D5 , 95% by HPLC; 98% atom D , 1173097-59-0
Synonym(s):
5-(Morpholinomethyl)-3-(2-nitrobenzylidenamino)-2-oxazolidinone-d5
CAS NO.：1173097-59-0
Empirical Formula: C15H18N4O5
Molecular Weight: 334.33
MDL number: MFCD06656261
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 147-148°C |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| color | Pale Yellow |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | 1S/C15H18N4O5/c20-15-18(11-13(24-15)10-17-5-7-23-8-6-17)16-9-12-3-1-2-4-14(12)19(21)22/h1-4,9,13H,5-8,10-11H2/b16-9+/i10D2,11D2,13D |
| InChIKey | PCYAMVONOKWOLP-ZHXFMVBBSA-N |
| SMILES | [2H]C([2H])(N1CCOCC1)C2([2H])OC(=O)N(\N=C\c3ccccc3[N+]([O-])=O)C2([2H])[2H] |
Description and Uses
A labelled derivatized of AMOZ (A634600), a metabolite of Nitrofuran.Environmental contaminants; Food contaminants; Heat processing contaminants
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |