LN-604126
9-Hydroxy Propantheline BroMide , 98% HPLC , 93446-02-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 184-186°C |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) pharmaceutical |
| InChI | 1S/C23H30NO4.BrH/c1-16(2)24(5,17(3)4)14-15-27-22(25)23(26)18-10-6-8-12-20(18)28-21-13-9-7-11-19(21)23;/h6-13,16-17,26H,14-15H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | RDMADSXCPWAZRH-UHFFFAOYSA-M |
| SMILES | [Br-].[N+](C(C)C)(C(C)C)(CCOC(=O)C1(c2c(cccc2)Oc3c1cccc3)O)C |
Description and Uses
A major impurity of the antimuscarinic agent Propantheline Bromide (P760900).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
