LN-632233
2 7-DI(TERT-BUTYL)-9-FLUORENYLMETHYL , 98% , 287381-46-8
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 66-70 °C(lit.) |
| Boiling point: | 447.8±14.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| InChI | 1S/C23H27ClO2/c1-22(2,3)14-7-9-16-17-10-8-15(23(4,5)6)12-19(17)20(18(16)11-14)13-26-21(24)25/h7-12,20H,13H2,1-6H3 |
| InChIKey | PHUMWWRUIGKGNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc-2c(c1)C(COC(Cl)=O)c3cc(ccc-23)C(C)(C)C |
Description and Uses
2,7-Di-tert-butyl-9-fluorenylmethyl chloroformate may be used in the preparation of polymer-supported (2,7-di-tert-butyl-9-fluorenyl)methyl succinimidyl carbonate (Dtb-Fmoc-P-OSu), a polymeric reagent for protecting amino groups.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
