LN-649828
3-CYANO-7-METHOXYCOUMARIN , 0.95&0.99 , 13229-92-0
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 210-212 °C |
| Boiling point: | 389.4±42.0 °C(Predicted) |
| Density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| color | pale yellow |
| InChI | 1S/C11H7NO3/c1-14-9-3-2-7-4-8(6-12)11(13)15-10(7)5-9/h2-5H,1H3 |
| InChIKey | GGAFPIBJPYCFGR-UHFFFAOYSA-N |
| SMILES | COc1ccc2C=C(C#N)C(=O)Oc2c1 |
Description and Uses
3-Cyano-7-methoxycoumarin can be used as a fluorophore in cytochrome P450 (CYP)-based fluorescent assays.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P301+P310-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 2932209090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |