LN-651533
5-chloro-6-(2,3-dichorophenoxy)-2-thio-1H-benzimidazole , 0.95 , 68828-69-3
CAS NO.:68828-69-3
Empirical Formula: C13H7Cl3N2OS
Molecular Weight: 345.63
MDL number: MFCD17215081
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 427.4±55.0 °C(Predicted) |
| Density | 1.66±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 9.21±0.30(Predicted) |
| form | neat |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C13H7Cl3N2OS/c14-6-2-1-3-10(12(6)16)19-11-5-9-8(4-7(11)15)17-13(20)18-9/h1-5H,(H2,17,18,20) |
| InChIKey | FUAVONSJNAMFPO-UHFFFAOYSA-N |
| SMILES | C1(=S)NC2=CC(OC3=CC=CC(Cl)=C3Cl)=C(Cl)C=C2N1 |
Description and Uses
5-Chloro-6-(2,3-dichlorophenoxy)-1,3-dihydro-2H-Benzimidazole-2-thione is used in the preparation of triclabendazoles which are drugs used to treat liver fluke.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |



![6-Chloro-5-(2,3-dichlorophenoxy)-2-(methylsulfinyl)-1H-benzo[d]imidazole](https://img.chemicalbook.com/CAS/GIF/100648-13-3.gif)

