LN-672234
Diacetic Aceclofenac , 0.95 , 1216495-92-9
CAS NO.：1216495-92-9
Empirical Formula: C20H17Cl2NO8
Molecular Weight: 470.26
MDL number: MFCD17170096
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 118 - 121°C |
| Boiling point: | 617.0±55.0 °C(Predicted) |
| Density | 1.486±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Ethyl Acetate (Slightly) |
| pka | 2.46±0.10(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C20H17Cl2NO8/c21-13-5-3-6-14(22)20(13)23-15-7-2-1-4-12(15)8-17(26)30-10-19(28)31-11-18(27)29-9-16(24)25/h1-7,23H,8-11H2,(H,24,25) |
| InChIKey | ZCCRLKICIDWHKV-UHFFFAOYSA-N |
| SMILES | Clc1c(c(ccc1)Cl)Nc2c(cccc2)CC(=O)OCC(=O)OCC(=O)OCC(=O)O |
Description and Uses
A 2-[(2,6-dichlorophenyl)amino]phenylacetoxyacetyl derivative as anti-inflammmatory and analgesic agent. (Aceclofenac EP Impurity H)
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
