LN-700414
1-[2-(2,4-difluorophenyl)-2,3-epoxypropyl]-1h-1,2,4-triazole , 90%+ , 86386-76-7
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 70-73°C |
| Boiling point: | 370.5±52.0 °C(Predicted) |
| Density | 1.46±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Hexanes (Sligh |
| pka | 2.75±0.10(Predicted) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C11H9F2N3O/c12-8-1-2-9(10(13)3-8)11(5-17-11)4-16-7-14-6-15-16/h1-3,6-7H,4-5H2 |
| InChIKey | UIXQTZYZQHYHRL-UHFFFAOYSA-N |
| SMILES | Fc1c(ccc(c1)F)C3(OC3)C[n]2ncnc2 |
Description and Uses
1-[2-(2,4-Difluorophenyl)-2,3-epoxypropyl]-1H-1,2,4-triazole is an epoxy impurity of the antifungal agent Fluconazole (F421000).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |

![1-[2-(2,4-difluorophenyl)-2,3-epoxypropyl]-1h-1,2,4-triazole](https://img.chemicalbook.com/CAS/GIF/86386-76-7.gif)





