LN-798514
TEMAFLOXACIN , 99.9% , 108319-06-8
CAS NO.:108319-06-8
Empirical Formula: C21H18F3N3O3
Molecular Weight: 417.38
MDL number: MFCD00864828
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >200°C (dec.) |
| Boiling point: | 608.9±55.0 °C(Predicted) |
| Density | 1.3372 (estimate) |
| storage temp. | 2-8°C(protect from light) |
| solubility | Aqueous Acid (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 6.02±0.41(Predicted) |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C21H18F3N3O3/c1-11-9-26(5-4-25-11)19-8-18-13(7-16(19)24)20(28)14(21(29)30)10-27(18)17-3-2-12(22)6-15(17)23/h2-3,6-8,10-11,25H,4-5,9H2,1H3,(H,29,30) |
| InChIKey | QKDHBVNJCZBTMR-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C(F)C=C2F)C2=C(C=C(F)C(N3CCNC(C)C3)=C2)C(=O)C(C(O)=O)=C1 |
Description and Uses
Temafloxacin is a fluoroquinolone antibiotic that acts as a DNA topoisomerase inhibitor. It has broad antimicrobial activity against gram-positive and gram-negative bacteria, such as S. pneumoniae, M. hominis, and anaerobic bacteria, including B. fragilis.
Antibacterial (microbial DNA topoisomerase inhibitor).





