LN-840834
H 128/80 , 0.95 , 29122-74-5
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >90°C (dec.) |
| Boiling point: | 402.5±35.0 °C(Predicted) |
| Density | 1.105±0.06 g/cm3(Predicted) |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 13.76±0.20(Predicted) |
| color | Pale Orange to Brown |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C13H19NO3/c1-10(2)14-7-12(16)9-17-13-5-3-11(8-15)4-6-13/h3-6,8,10,12,14,16H,7,9H2,1-2H3 |
| InChIKey | BGHLBXLHZRCXRY-UHFFFAOYSA-N |
| SMILES | Cl.CC(C)NCC(O)COc1ccc(C=O)cc1 |
Description and Uses
A Labelled metoprolol impurity .
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 3 |
| HS Code | 2922504500 |
| Storage Class | 11 - Combustible Solids |
