LN-848534
DESMETHYL BOSENTAN , 0.95 , 253688-61-8
CAS NO.:253688-61-8
Empirical Formula: C26H27N5O6S
Molecular Weight: 537.59
MDL number: MFCD09840361
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 739.2±70.0 °C(Predicted) |
| Density | 1.376±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Acetonitrile: soluble,DMSO: soluble,Methanol: soluble |
| form | A solid |
| pka | 3.92±0.10(Predicted) |
| Major Application | pharmaceutical small molecule |
| InChIKey | STTLKJGYAWXIPP-UHFFFAOYSA-N |
| SMILES | C1(S(NC2C(OC3=CC=CC=C3O)=C(OCCO)N=C(C3=NC=CC=N3)N=2)(=O)=O)=CC=C(C(C)(C)C)C=C1 |
Description and Uses
DESMETHYL BOSENTAN is a metabolite of Bosentan, a mixed endothelin receptor antagonist which is used as a vasodilator
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| WGK Germany | WGK 2 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Repr. 2 |







