LN-867534
16α,17-[(1RS)-Butylidenebis(oxy)]-11β-hydroxy-17-(hydroxyMethyl)-D-hoMoandrosta-1,4-diene-3,17a-dione (Mixture of DiastereoMers) , 0.95 , 1040085-99-1
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | >98°C (dec.) |
| Boiling point: | 607.0±55.0 °C(Predicted) |
| Density | 1.27±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated), Ethyl Acetate |
| pka | 13.77±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Major Application | pharmaceutical small molecule |
| InChIKey | DRLZLIQUOCVRLM-PINIVEOHSA-N |
| SMILES | O1[C@]2([H])C[C@]3([H])[C@@](C)(C(=O)[C@]2(CO)OC1CCC)C[C@H](O)[C@@]1([H])[C@@]3([H])CCC2[C@]1(C)C=CC(=O)C=2 |
Description and Uses
16α,17-[(1RS)-butylidenebis(oxy)]-11β-hydroxy-17-(hydroxymethyl)-D-homoandrosta-1,4-diene-3,17a-dione is an impurity of Budesonide (B689490), an antiinflammatory agent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| target organs | Adrenal gland |
| WGK Germany | WGK 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 Repr. 2 Skin Sens. 1 STOT RE 1 Inhalation |

![16α,17-[(1RS)-Butylidenebis(oxy)]-11β-hydroxy-17-(hydroxyMethyl)-D-hoMoandrosta-1,4-diene-3,17a-dione (Mixture of DiastereoMers)](https://img.chemicalbook.com/CAS/GIF/1040085-99-1.gif)




