LN-943231
7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin , 76877-33-3
Synonym(s):
1H-Pyrrole-2,5-dione, 1-(4-(7-(diethylamino)-4-methyl-2-oxo-2H-1-benzopyran-3-yl)phenyl)-;Anti-Carboxypeptidase M precursor antibody produced in rabbit;Carboxypeptidase M;CPM
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 220-223°C |
| Boiling point: | 618.7±55.0 °C(Predicted) |
| Density | 1.302±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | DMSO: soluble |
| pka | 3.28±0.20(Predicted) |
| form | solid |
| color | yellow |
| Appearance | Yellow to Dark Orange Solid |
| biological source | rabbit |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C24H22N2O4/c1-4-25(5-2)18-10-11-19-15(3)23(24(29)30-20(19)14-18)16-6-8-17(9-7-16)26-21(27)12-13-22(26)28/h6-14H,4-5H2,1-3H3 |
| InChIKey | YGIABALXNBVHBX-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2C(C)=C(C(=O)Oc2c1)c3ccc(cc3)N4C(=O)C=CC4=O |
Description and Uses
7-Diethylamino-3-(4-maleimidophenyl)-4-methylcoumarin is a thiol-reactive fluorescent probe. It displays excitation/emission maxima of 387/468 nm, respectively, and fluorescence intensity increases when bound to cysteine residues.
(7-Diethylamino-3-(4'-maleimidylphenyl)-4- methylcoumarin)CPM is probably the most widely used blue fluorescent thiol-reactive dye. This maleimide derivative of coumarin is essentially nonfluorescent until it reacts with thiols, making it possible to quantify thiols without a separation step. CPM is a good energ
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P330-P302+P352-P321-P304+P340-P305+P351+P338-P332+P313-P362+P364-P337+P313-P403+P233-P405-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
