LN-9598Po
Posaconazole-d4 , 96% , 1133712-26-1
CAS NO.:1133712-26-1
Empirical Formula: C37H42F2N8O4
Molecular Weight: 700.79
MDL number: MFCD28899339
Update time: 2023-04-23
PRODUCT Properties
| Melting point: | 170-172C |
| storage temp. | -20°C Freezer |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly, Heated) |
| form | Solid |
| color | Off-White to Light Grey |
| Stability: | Moisture Sensitive |
| InChIKey | RAGOYPUPXAKGKH-YWOVKAAPSA-N |
| SMILES | FC1=CC(F)=CC=C1[C@]2(CN3C=NC=N3)OC[C@@H](COC4=CC=C(N5CCN(C6=C([2H])C([2H])=C(N7C=NN([C@@H](CC)[C@@H](O)C)C7=O)C([2H])=C6[2H])CC5)C=C4)C2 |
Description and Uses
Orally active labelled triazole antifungal.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H301+H311+H331-H370 |
| Precautionary statements | P210-P233-P280-P301+P310-P303+P361+P353-P304+P340+P311 |
| target organs | Eyes |
| WGK Germany | WGK 2 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |






![1H-1,2,4-TRIAZOLE, 1-[[(2S)-2-(2,4-DIFLUOROPHENYL)OXIRANYL]METHYL]-](https://img.chemicalbook.com/CAS/GIF/141113-42-0.gif)


![1,?3-?Propanediol,2-?[2-?(2,?4-?difluorophenyl)?-?2-?propen-?1-?yl]?-](https://img.chemicalbook.com/CAS/GIF/165115-73-1.gif)