LN-ID-CCY
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride , 99% , 52314-67-7
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 70-80°C (15 torr) |
| Density | 1.23 |
| vapor pressure | 8.3Pa at 25℃ |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Oil |
| color | Colourless to Light Yellow |
| Water Solubility | 123.2mg/L at 25℃ |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C8H9Cl3O/c1-8(2)4(3-5(9)10)6(8)7(11)12/h3-4,6H,1-2H3 |
| InChIKey | CHLAOFANYRDCPD-UHFFFAOYSA-N |
| SMILES | C(Cl)(C1C(/C=C(/Cl)\Cl)C1(C)C)=O |
| LogP | 2.82 at 25℃ |
| EPA Substance Registry System | Cyclopropanecarbonyl chloride, 3-(2,2-dichloroethenyl)-2,2-dimethyl- (52314-67-7) |
Description and Uses
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride can be used as an important intermediate of pyrethroids to prepare pesticides such as permethrin, cypermethrin, beta-cypermethrin, pentenyl cypermethrin, etc.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS09,GHS06 |
| Signal word | Danger |
| Hazard statements | H317-H301-H315-H410-H373-H335-H332 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P260-P314-P501-P273-P391-P501-P264-P280-P302+P352-P321-P332+P313-P362-P261-P271-P304+P340-P312-P261-P272-P280-P302+P352-P333+P313-P321-P363-P501 |






