LN-de_1Cy
Cyano temozolomide , 98% , 114601-31-9
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 415.3±37.0 °C(Predicted) |
| Density | 1.74±0.1 g/cm3(Predicted) |
| solubility | Acetone (Slightly), DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol |
| form | Solid |
| pka | -1.85±0.20(Predicted) |
| color | Pale Yellow to Pale Brown |
| InChI | InChI=1S/C6H4N6O/c1-11-6(13)12-3-8-4(2-7)5(12)9-10-11/h3H,1H3 |
| InChIKey | VVSHZIRQNZADET-UHFFFAOYSA-N |
| SMILES | N1(C)C(=O)N2C=NC(C#N)=C2N=N1 |
Description and Uses
Cyano temozolomide is an impurity of temozolomide, a cytotoxic antitumour prodrug targeting malignant brain tumours.
8-Descarboxamido-8-cyano Temozolomide is a useful synthetic intermediate in the synthesis of Temozolomide (T017775); an imidazotetrazine alkylating agent and antineoplastic.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |







