LN-heny11
1,1-Bis(4-cyanatophenyl)ethane , 99% , 47073-92-7
Update time: 2023-04-23
PRODUCT Properties
| Boiling point: | 383°C |
| Density | 1.196 |
| vapor pressure | 0Pa at 20℃ |
| Flash point: | 149°C |
| storage temp. | Storage temp. 2-8°C |
| Appearance | Light yellow to brown Liquid |
| Water Solubility | 1.6mg/L at 23℃ |
| InChI | InChI=1S/C16H12N2O2/c1-12(13-2-6-15(7-3-13)19-10-17)14-4-8-16(9-5-14)20-11-18/h2-9,12H,1H3 |
| InChIKey | SIZDMAYTWUINIG-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(OC#N)C=C1)C(C)C1C=CC(OC#N)=CC=1 |
| LogP | 5.3 at 0℃ |
| EPA Substance Registry System | Cyanic acid, ethylidenedi-4,1-phenylene ester (47073-92-7) |
Description and Uses
Primaset(R) LECy is a low viscosity, liquid monomer suitable for filament winding, resin transfer molding (RTM), low cost vacuum-assisted RTM (VARTM), resin liquid infiltration pultrusion, reactive diluent, die attach adhesive and liquid encapsulation.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H318-H332-H373-H400-H410 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P280-P305+P351+P338-P310-P261-P271-P304+P340-P312-P260-P314-P273-P391 |
| Hazard Codes | Xn,N |
| Risk Statements | 20/22-41-48/22-50/53 |
| Safety Statements | 26-36/37/39-60-61 |







