LN0288258
5-Benzoyl-2,3-dihydro-1H-pyrrolizin-1-one , 95%+ , 113502-52-6
| Pack Size | Price | Stock | Quantity |
| 25mg | RMB1200.00 | In Stock |
|
| 100mg | RMB2400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 427.9±33.0 °C(Predicted) |
| Density | 1.26±0.1 g/cm3(Predicted) |
| storage temp. | 2-30°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | -11.95±0.20(Predicted) |
| color | Light Yellow to Yellow |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C14H11NO2/c16-13-8-9-15-11(13)6-7-12(15)14(17)10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | NFKBMHXYCKRXPQ-UHFFFAOYSA-N |
| SMILES | [n]21c(ccc2C(=O)c3ccccc3)C(=O)CC1 |
Description and Uses
Ketorolac impurity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2933998350 |
| Storage Class | 13 - Non Combustible Solids |
