LN0453039
98% , 845729-41-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB2021.60 | In Stock |
|
| 250mg | RMB3369.60 | In Stock |
|
| 1g | RMB6739.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 134 - 136°C |
| Boiling point: | 481.5±40.0 °C(Predicted) |
| Density | 1.379±0.06 g/cm3(Predicted) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -2.85±0.20(Predicted) |
| form | Solid |
| color | Light Yellow |
| InChI | InChI=1S/C10H10N2O4/c13-10-7-16-6-5-11(10)8-3-1-2-4-9(8)12(14)15/h1-4H,5-7H2 |
| InChIKey | OXVFGUUCIPAZSM-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2[N+]([O-])=O)CCOCC1=O |
Description and Uses
4-(2-Nitrophenyl)morpholin-3-one is an intermediate in the synthesis of 4-(2-Aminophenyl)-3-morpholinone (A625985). 4-(2-Aminophenyl)-3-morpholinone is a reagent used in the preparation of various Morpholine based pharmaceuticals.
