LN0509539
97% , 1770812-37-7
Synonym(s):
(S)-4,5-Dichloro-N-({2-oxo-3-[4-(3-oxomorpholino)phenyl]oxazolidin-5-yl}methyl)thiophene2-carboxamide
CAS NO.:1770812-37-7
Empirical Formula: C19H17Cl2N3O5S
Molecular Weight: 470.33
MDL number: MFCD28347519
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB1680.00 | In Stock |
|
| 250mg | RMB2800.00 | In Stock |
|
| 1g | RMB5600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 718.5±60.0 °C(Predicted) |
| Density | 1.514±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.52±0.46(Predicted) |
| color | White to Off-White |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C19H17Cl2N3O5S/c20-14-7-15(30-17(14)21)18(26)22-8-13-9-24(19(27)29-13)12-3-1-11(2-4-12)23-5-6-28-10-16(23)25/h1-4,7,13H,5-6,8-10H2,(H,22,26)/t13-/m0/s1 |
| InChIKey | CCLKYVZRBJQFLK-ZDUSSCGKSA-N |
| SMILES | [s]1c(c(cc1C(=O)NC[C@@H]2OC(=O)N(C2)c3ccc(cc3)N4CCOCC4=O)Cl)Cl |
Description and Uses
4,5-Dichloro-N-[[(5S)-2-oxo-3-[4-(3-oxo-4-morpholinyl)phenyl]-5-oxazolidinyl]methyl]-2-thiophenecarboxamide is an impurity of Rivaroxaban (R538000), a novel antithrombotic agent. A highly potent and selective, direct FXa inhibitor.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Hazard statements | H411 |
| Precautionary statements | P273-P391-P501 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |







