LN0784854
95% , 28343-61-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB3116.00 | In Stock |
|
| 250mg | RMB4446.40 | In Stock |
|
| 500mg | RMB7009.60 | In Stock |
|
| 1g | RMB8985.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 262-264 °C(Solv: ethanol (64-17-5)) |
| Boiling point: | 355.0±42.0 °C(Predicted) |
| Density | 1.75±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.67±0.33(Predicted) |
| color | Off-White to Pale Beige |
| Major Application | agriculture environmental |
| InChI | 1S/C8HCl3N2O/c9-5-3(1-12)6(10)7(11)8(14)4(5)2-13/h14H |
| InChIKey | MDQKYGOECVSPIW-UHFFFAOYSA-N |
| SMILES | ClC1=C(C#N)C(Cl)=C(Cl)C(O)=C1C#N |
| EPA Substance Registry System | 1,3-Benzenedicarbonitrile, 2,4,5-trichloro-6-hydroxy- (28343-61-5) |
Description and Uses
Hydroxychlorothalonil is a metabolite of Chlorothalonil (C411250).
Safety
| Symbol(GHS) |   GHS08,GHS06 |
| Signal word | Danger |
| Hazard statements | H373-H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501-P260-P314-P501 |
| target organs | Respiratory system |
| WGK Germany | WGK 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Dam. 1 Skin Sens. 1 STOT SE 3 |
