LN0947557
98% , 492444-39-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB3376.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 173 - 175oC |
| Boiling point: | 548.7±50.0 °C(Predicted) |
| Density | 1.29±0.1 g/cm3(Predicted) |
| storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere |
| solubility | Acetonitrile (Slightly), Chloroform (Slightly) |
| pka | 7.63±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C19H23ClN4O2/c1-23-5-7-24(8-6-23)4-3-9-26-18-11-16-15(10-17(18)25-2)19(20)14(12-21)13-22-16/h10-11,13H,3-9H2,1-2H3 |
| InChIKey | DLILOBLDMMRASC-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(OC)=C(OCCCN3CCN(C)CC3)C=2)C(Cl)=C(C#N)C=1 |
Description and Uses
4-Chloro-3-cyano-6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinoline is a useful reagent to prepare?benzofuranyl derivatives for treating solid tumours. It is also an impurity of Bosutinib.





